C18H16F3NO3 — CID 2520046
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2,5-dimethylbenzoate (PubChem CID 2520046) has the molecular formula C18H16F3NO3 and a molecular weight of 351.32 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2,5-dimethylbenzoate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 2520046 |
| Molecular Formula | C18H16F3NO3 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2,5-dimethylbenzoate |
| SMILES | Cc1ccc(C)c(C(=O)OCC(=O)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3NO3/c1-11-7-8-12(2)13(9-11)17(24)25-10-16(23)22-15-6-4-3-5-14(15)18(19,20)21/h3-9H,10H2,1-2H3,(H,22,23) |
| InChIKey | JVZTYRGSILFBBT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |