C22H19F3N2O3 — CID 4853936
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate (PubChem CID 4853936) has the molecular formula C22H19F3N2O3 and a molecular weight of 416.40 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4853936 |
| Molecular Formula | C22H19F3N2O3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)Nc2ccccc2C(F)(F)F)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H19F3N2O3/c1-14-12-17(15(2)27(14)16-8-4-3-5-9-16)21(29)30-13-20(28)26-19-11-7-6-10-18(19)22(23,24)25/h3-12H,13H2,1-2H3,(H,26,28) |
| InChIKey | YRMSODBNAXABKW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|