C21H17ClF2N2O3 — CID 4031076
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 4031076) has the molecular formula C21H17ClF2N2O3 and a molecular weight of 418.83 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4031076 |
| Molecular Formula | C21H17ClF2N2O3 |
| Molecular Weight | 418.83 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)Nc2ccc(F)cc2Cl)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17ClF2N2O3/c1-12-9-17(13(2)26(12)16-6-3-14(23)4-7-16)21(28)29-11-20(27)25-19-8-5-15(24)10-18(19)22/h3-10H,11H2,1-2H3,(H,25,27) |
| InChIKey | DSDVEPDCZIMWBG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.83 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|