C24H25FN2O6 — CID 41399295
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 41399295) has the molecular formula C24H25FN2O6 and a molecular weight of 456.47 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 41399295 |
| Molecular Formula | C24H25FN2O6 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)cc(OC)c1OC |
| InChI | InChI=1S/C24H25FN2O6/c1-14-10-19(15(2)27(14)18-8-6-16(25)7-9-18)24(29)33-13-22(28)26-17-11-20(30-3)23(32-5)21(12-17)31-4/h6-12H,13H2,1-5H3,(H,26,28) |
| InChIKey | WWLILUICBKVRDA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|