C22H23ClN2O4 — CID 47065466
1-(4-chlorophenyl)-2,5-dimethyl-N-(3,4,5-trimethoxyphenyl)pyrrole-3-carboxamide (PubChem CID 47065466) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,5-dimethyl-N-(3,4,5-trimethoxyphenyl)pyrrole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-2,5-dimethyl-N-(3,4,5-trimethoxyphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 47065466 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-(4-chlorophenyl)-2,5-dimethyl-N-(3,4,5-trimethoxyphenyl)pyrrole-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(C)n(-c3ccc(Cl)cc3)c2C)cc(OC)c1OC |
| InChI | InChI=1S/C22H23ClN2O4/c1-13-10-18(14(2)25(13)17-8-6-15(23)7-9-17)22(26)24-16-11-19(27-3)21(29-5)20(12-16)28-4/h6-12H,1-5H3,(H,24,26) |
| InChIKey | HHJOHRDISHENOB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|