C21H20ClFN2O3 — CID 35864833
N-(5-chloro-2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 35864833) has the molecular formula C21H20ClFN2O3 and a molecular weight of 402.85 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 35864833 |
| Molecular Formula | C21H20ClFN2O3 |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)cc1Cl |
| InChI | InChI=1S/C21H20ClFN2O3/c1-12-9-16(13(2)25(12)15-7-5-14(23)6-8-15)21(26)24-18-10-17(22)19(27-3)11-20(18)28-4/h5-11H,1-4H3,(H,24,26) |
| InChIKey | IUWUBFGVVHFRFD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|