C15H14ClNO4 — CID 772092
N-(5-chloro-2,4-dimethoxyphenyl)-2-hydroxybenzamide (PubChem CID 772092) has the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-2-hydroxybenzamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 772092 |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-hydroxybenzamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccccc2O)cc1Cl |
| InChI | InChI=1S/C15H14ClNO4/c1-20-13-8-14(21-2)11(7-10(13)16)17-15(19)9-5-3-4-6-12(9)18/h3-8,18H,1-2H3,(H,17,19) |
| InChIKey | BSCKAWLHRXNJFK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |