C15H14ClNO3 — CID 835257
N-(5-chloro-2,4-dimethoxyphenyl)benzamide (PubChem CID 835257) has the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)benzamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 835257 |
| Molecular Formula | C15H14ClNO3 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)benzamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C15H14ClNO3/c1-19-13-9-14(20-2)12(8-11(13)16)17-15(18)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,17,18) |
| InChIKey | SAJKJVHSYRFBGH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |