C15H13ClFNO3 — CID 4060765
N-(4-chloro-2,5-dimethoxyphenyl)-3-fluorobenzamide (PubChem CID 4060765) has the molecular formula C15H13ClFNO3 and a molecular weight of 309.72 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-3-fluorobenzamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 4060765 |
| Molecular Formula | C15H13ClFNO3 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-fluorobenzamide |
| SMILES | COc1cc(NC(=O)c2cccc(F)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C15H13ClFNO3/c1-20-13-8-12(14(21-2)7-11(13)16)18-15(19)9-4-3-5-10(17)6-9/h3-8H,1-2H3,(H,18,19) |
| InChIKey | PYSJSEDXUZURDM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |