C17H16ClNO5 — CID 46485057
methyl 3-[(4-chloro-2,5-dimethoxyphenyl)carbamoyl]benzoate (PubChem CID 46485057) has the molecular formula C17H16ClNO5 and a molecular weight of 349.77 g/mol. Its IUPAC name is methyl 3-[(4-chloro-2,5-dimethoxyphenyl)carbamoyl]benzoate.
| Compound Name | methyl 3-[(4-chloro-2,5-dimethoxyphenyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 46485057 |
| Molecular Formula | C17H16ClNO5 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | methyl 3-[(4-chloro-2,5-dimethoxyphenyl)carbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)Nc2cc(OC)c(Cl)cc2OC)c1 |
| InChI | InChI=1S/C17H16ClNO5/c1-22-14-9-13(15(23-2)8-12(14)18)19-16(20)10-5-4-6-11(7-10)17(21)24-3/h4-9H,1-3H3,(H,19,20) |
| InChIKey | WHMBALSBAKVKBP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |