C13H12ClNO3S — CID 17401848
N-(4-chloro-2,5-dimethoxyphenyl)thiophene-3-carboxamide (PubChem CID 17401848) has the molecular formula C13H12ClNO3S and a molecular weight of 297.76 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)thiophene-3-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 17401848 |
| Molecular Formula | C13H12ClNO3S |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)thiophene-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccsc2)c(OC)cc1Cl |
| InChI | InChI=1S/C13H12ClNO3S/c1-17-11-6-10(12(18-2)5-9(11)14)15-13(16)8-3-4-19-7-8/h3-7H,1-2H3,(H,15,16) |
| InChIKey | SPFLPIOUKCEMSP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |