C13H10N2O2S — CID 113460384
N-(4-cyano-2-methoxyphenyl)thiophene-3-carboxamide (PubChem CID 113460384) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is N-(4-cyano-2-methoxyphenyl)thiophene-3-carboxamide.
| Compound Name | N-(4-cyano-2-methoxyphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 113460384 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | N-(4-cyano-2-methoxyphenyl)thiophene-3-carboxamide |
| SMILES | COc1cc(C#N)ccc1NC(=O)c1ccsc1 |
| InChI | InChI=1S/C13H10N2O2S/c1-17-12-6-9(7-14)2-3-11(12)15-13(16)10-4-5-18-8-10/h2-6,8H,1H3,(H,15,16) |
| InChIKey | NOFHSYYUDHAYTL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |