C12H10N4O2S — CID 104848874
2-amino-N-(4-cyano-2-methoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 104848874) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-amino-N-(4-cyano-2-methoxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(4-cyano-2-methoxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 104848874 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-amino-N-(4-cyano-2-methoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1cc(C#N)ccc1NC(=O)c1csc(N)n1 |
| InChI | InChI=1S/C12H10N4O2S/c1-18-10-4-7(5-13)2-3-8(10)15-11(17)9-6-19-12(14)16-9/h2-4,6H,1H3,(H2,14,16)(H,15,17) |
| InChIKey | BXNBFIASWMDLHE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |