C14H11FN4O2 — CID 105387348
2-amino-N-(4-cyano-2-methoxyphenyl)-3-fluoropyridine-4-carboxamide (PubChem CID 105387348) has the molecular formula C14H11FN4O2 and a molecular weight of 286.27 g/mol. Its IUPAC name is 2-amino-N-(4-cyano-2-methoxyphenyl)-3-fluoropyridine-4-carboxamide.
| Compound Name | 2-amino-N-(4-cyano-2-methoxyphenyl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387348 |
| Molecular Formula | C14H11FN4O2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-amino-N-(4-cyano-2-methoxyphenyl)-3-fluoropyridine-4-carboxamide |
| SMILES | COc1cc(C#N)ccc1NC(=O)c1ccnc(N)c1F |
| InChI | InChI=1S/C14H11FN4O2/c1-21-11-6-8(7-16)2-3-10(11)19-14(20)9-4-5-18-13(17)12(9)15/h2-6H,1H3,(H2,17,18)(H,19,20) |
| InChIKey | QHJCFUFBBWZPOP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |