C12H8ClF2N3O — CID 105385883
2-amino-N-(4-chloro-2-fluorophenyl)-3-fluoropyridine-4-carboxamide (PubChem CID 105385883) has the molecular formula C12H8ClF2N3O and a molecular weight of 283.67 g/mol. Its IUPAC name is 2-amino-N-(4-chloro-2-fluorophenyl)-3-fluoropyridine-4-carboxamide.
| Compound Name | 2-amino-N-(4-chloro-2-fluorophenyl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 105385883 |
| Molecular Formula | C12H8ClF2N3O |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 2-amino-N-(4-chloro-2-fluorophenyl)-3-fluoropyridine-4-carboxamide |
| SMILES | Nc1nccc(C(=O)Nc2ccc(Cl)cc2F)c1F |
| InChI | InChI=1S/C12H8ClF2N3O/c13-6-1-2-9(8(14)5-6)18-12(19)7-3-4-17-11(16)10(7)15/h1-5H,(H2,16,17)(H,18,19) |
| InChIKey | LJCCHVJGQSYDID-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |