C12H6ClF2IN2O — CID 107470498
N-(4-chloro-2-iodophenyl)-2,3-difluoropyridine-4-carboxamide (PubChem CID 107470498) has the molecular formula C12H6ClF2IN2O and a molecular weight of 394.55 g/mol. Its IUPAC name is N-(4-chloro-2-iodophenyl)-2,3-difluoropyridine-4-carboxamide.
| Compound Name | N-(4-chloro-2-iodophenyl)-2,3-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 107470498 |
| Molecular Formula | C12H6ClF2IN2O |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 393.92 |
| IUPAC Name | N-(4-chloro-2-iodophenyl)-2,3-difluoropyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1I)c1ccnc(F)c1F |
| InChI | InChI=1S/C12H6ClF2IN2O/c13-6-1-2-9(8(16)5-6)18-12(19)7-3-4-17-11(15)10(7)14/h1-5H,(H,18,19) |
| InChIKey | HMWVYGIUSLNVSW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|