C12H7ClF2N2O — CID 105380159
N-(4-chlorophenyl)-2,3-difluoropyridine-4-carboxamide (PubChem CID 105380159) has the molecular formula C12H7ClF2N2O and a molecular weight of 268.65 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,3-difluoropyridine-4-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2,3-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380159 |
| Molecular Formula | C12H7ClF2N2O |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | N-(4-chlorophenyl)-2,3-difluoropyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccnc(F)c1F |
| InChI | InChI=1S/C12H7ClF2N2O/c13-7-1-3-8(4-2-7)17-12(18)9-5-6-16-11(15)10(9)14/h1-6H,(H,17,18) |
| InChIKey | AVEKFJKHQZCPOU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|