C13H8F4N2O2 — CID 105380332
N-[4-(difluoromethoxy)phenyl]-2,3-difluoropyridine-4-carboxamide (PubChem CID 105380332) has the molecular formula C13H8F4N2O2 and a molecular weight of 300.21 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2,3-difluoropyridine-4-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2,3-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380332 |
| Molecular Formula | C13H8F4N2O2 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2,3-difluoropyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)c1ccnc(F)c1F |
| InChI | InChI=1S/C13H8F4N2O2/c14-10-9(5-6-18-11(10)15)12(20)19-7-1-3-8(4-2-7)21-13(16)17/h1-6,13H,(H,19,20) |
| InChIKey | NDFXEZKVUAHLIF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|