C15H12F4N2O3 — CID 11537485
1,3-bis[4-(difluoromethoxy)phenyl]urea (PubChem CID 11537485) has the molecular formula C15H12F4N2O3 and a molecular weight of 344.26 g/mol. Its IUPAC name is 1,3-bis[4-(difluoromethoxy)phenyl]urea.
| Compound Name | 1,3-bis[4-(difluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 11537485 |
| Molecular Formula | C15H12F4N2O3 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1,3-bis[4-(difluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H12F4N2O3/c16-13(17)23-11-5-1-9(2-6-11)20-15(22)21-10-3-7-12(8-4-10)24-14(18)19/h1-8,13-14H,(H2,20,21,22) |
| InChIKey | FZVUCIFTSWXOPV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |