C14H20F2N2O3 — CID 110919120
1-[4-(difluoromethoxy)phenyl]-3-(2-ethyl-2-hydroxybutyl)urea (PubChem CID 110919120) has the molecular formula C14H20F2N2O3 and a molecular weight of 302.32 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-(2-ethyl-2-hydroxybutyl)urea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-(2-ethyl-2-hydroxybutyl)urea |
|---|---|
| PubChem CID | 110919120 |
| Molecular Formula | C14H20F2N2O3 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-(2-ethyl-2-hydroxybutyl)urea |
| SMILES | CCC(O)(CC)CNC(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H20F2N2O3/c1-3-14(20,4-2)9-17-13(19)18-10-5-7-11(8-6-10)21-12(15)16/h5-8,12,20H,3-4,9H2,1-2H3,(H2,17,18,19) |
| InChIKey | OROINZCWLCCDFS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |