C16H24F2N2O3 — CID 110910143
1-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-ethyl-2-hydroxybutyl)urea (PubChem CID 110910143) has the molecular formula C16H24F2N2O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-ethyl-2-hydroxybutyl)urea.
| Compound Name | 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-ethyl-2-hydroxybutyl)urea |
|---|---|
| PubChem CID | 110910143 |
| Molecular Formula | C16H24F2N2O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-ethyl-2-hydroxybutyl)urea |
| SMILES | CCC(O)(CC)CNC(=O)NC(C)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H24F2N2O3/c1-4-16(22,5-2)10-19-15(21)20-11(3)12-6-8-13(9-7-12)23-14(17)18/h6-9,11,14,22H,4-5,10H2,1-3H3,(H2,19,20,21) |
| InChIKey | KRHWHPJDTAVJNM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |