C12H16F2N2O3 — CID 110894255
1-[1-[3-(difluoromethoxy)phenyl]ethyl]-3-(2-hydroxyethyl)urea (PubChem CID 110894255) has the molecular formula C12H16F2N2O3 and a molecular weight of 274.27 g/mol. Its IUPAC name is 1-[1-[3-(difluoromethoxy)phenyl]ethyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[1-[3-(difluoromethoxy)phenyl]ethyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110894255 |
| Molecular Formula | C12H16F2N2O3 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-[1-[3-(difluoromethoxy)phenyl]ethyl]-3-(2-hydroxyethyl)urea |
| SMILES | CC(NC(=O)NCCO)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C12H16F2N2O3/c1-8(16-12(18)15-5-6-17)9-3-2-4-10(7-9)19-11(13)14/h2-4,7-8,11,17H,5-6H2,1H3,(H2,15,16,18) |
| InChIKey | REHXEOMPYMFZPG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |