C14H15F2NO2 — CID 167924571
N-[1-[3-(difluoromethoxy)phenyl]ethyl]bicyclo[1.1.0]butane-1-carboxamide (PubChem CID 167924571) has the molecular formula C14H15F2NO2 and a molecular weight of 267.27 g/mol. Its IUPAC name is N-[1-[3-(difluoromethoxy)phenyl]ethyl]bicyclo[1.1.0]butane-1-carboxamide.
| Compound Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]bicyclo[1.1.0]butane-1-carboxamide |
|---|---|
| PubChem CID | 167924571 |
| Molecular Formula | C14H15F2NO2 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]bicyclo[1.1.0]butane-1-carboxamide |
| SMILES | CC(NC(=O)C12CC1C2)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C14H15F2NO2/c1-8(17-12(18)14-6-10(14)7-14)9-3-2-4-11(5-9)19-13(15)16/h2-5,8,10,13H,6-7H2,1H3,(H,17,18) |
| InChIKey | JQXQIKQKJKORBG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |