C14H17F2NO2 — CID 94117441
N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-3-methylbut-2-enamide (PubChem CID 94117441) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-3-methylbut-2-enamide.
| Compound Name | N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 94117441 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)N[C@H](C)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C14H17F2NO2/c1-9(2)7-13(18)17-10(3)11-5-4-6-12(8-11)19-14(15)16/h4-8,10,14H,1-3H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | BDCHAUBBJVLIOG-SNVBAGLBSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|