C14H20F2N2O2 — CID 65225924
2-(aminomethyl)-N-[1-[3-(difluoromethoxy)phenyl]ethyl]butanamide (PubChem CID 65225924) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[1-[3-(difluoromethoxy)phenyl]ethyl]butanamide.
| Compound Name | 2-(aminomethyl)-N-[1-[3-(difluoromethoxy)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 65225924 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-(aminomethyl)-N-[1-[3-(difluoromethoxy)phenyl]ethyl]butanamide |
| SMILES | CCC(CN)C(=O)NC(C)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C14H20F2N2O2/c1-3-10(8-17)13(19)18-9(2)11-5-4-6-12(7-11)20-14(15)16/h4-7,9-10,14H,3,8,17H2,1-2H3,(H,18,19) |
| InChIKey | JSXZPGXRVHLMNA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |