C14H20F2N2O2S — CID 104907136
(2R)-2-amino-N-[1-[3-(difluoromethoxy)phenyl]ethyl]-4-methylsulfanylbutanamide (PubChem CID 104907136) has the molecular formula C14H20F2N2O2S and a molecular weight of 318.39 g/mol. Its IUPAC name is (2R)-2-amino-N-[1-[3-(difluoromethoxy)phenyl]ethyl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-[1-[3-(difluoromethoxy)phenyl]ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104907136 |
| Molecular Formula | C14H20F2N2O2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (2R)-2-amino-N-[1-[3-(difluoromethoxy)phenyl]ethyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)NC(C)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C14H20F2N2O2S/c1-9(18-13(19)12(17)6-7-21-2)10-4-3-5-11(8-10)20-14(15)16/h3-5,8-9,12,14H,6-7,17H2,1-2H3,(H,18,19)/t9?,12-/m1/s1 |
| InChIKey | VOKTYKDQGMSEJT-FFFFSGIJSA-N |
| XLogP | 2.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |