C13H18F2N2O2S — CID 119311563
(2S)-2-amino-N-[[3-(difluoromethoxy)phenyl]methyl]-4-methylsulfanylbutanamide (PubChem CID 119311563) has the molecular formula C13H18F2N2O2S and a molecular weight of 304.36 g/mol. Its IUPAC name is (2S)-2-amino-N-[[3-(difluoromethoxy)phenyl]methyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[[3-(difluoromethoxy)phenyl]methyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119311563 |
| Molecular Formula | C13H18F2N2O2S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (2S)-2-amino-N-[[3-(difluoromethoxy)phenyl]methyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C13H18F2N2O2S/c1-20-6-5-11(16)12(18)17-8-9-3-2-4-10(7-9)19-13(14)15/h2-4,7,11,13H,5-6,8,16H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | TYVIDODYXAABHZ-NSHDSACASA-N |
| XLogP | 1.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |