C14H21FN2O2S — CID 119335650
(2S)-2-amino-N-[2-(3-fluorophenoxy)propyl]-4-methylsulfanylbutanamide (PubChem CID 119335650) has the molecular formula C14H21FN2O2S and a molecular weight of 300.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(3-fluorophenoxy)propyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(3-fluorophenoxy)propyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119335650 |
| Molecular Formula | C14H21FN2O2S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2S)-2-amino-N-[2-(3-fluorophenoxy)propyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCC(C)Oc1cccc(F)c1 |
| InChI | InChI=1S/C14H21FN2O2S/c1-10(19-12-5-3-4-11(15)8-12)9-17-14(18)13(16)6-7-20-2/h3-5,8,10,13H,6-7,9,16H2,1-2H3,(H,17,18)/t10?,13-/m0/s1 |
| InChIKey | HSJYQPWYCKFWFI-HQVZTVAUSA-N |
| XLogP | 1.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |