C15H23F2NO2 — CID 103913178
6-[1-[3-(difluoromethoxy)phenyl]ethylamino]hexan-1-ol (PubChem CID 103913178) has the molecular formula C15H23F2NO2 and a molecular weight of 287.35 g/mol. Its IUPAC name is 6-[1-[3-(difluoromethoxy)phenyl]ethylamino]hexan-1-ol.
| Compound Name | 6-[1-[3-(difluoromethoxy)phenyl]ethylamino]hexan-1-ol |
|---|---|
| PubChem CID | 103913178 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 6-[1-[3-(difluoromethoxy)phenyl]ethylamino]hexan-1-ol |
| SMILES | CC(NCCCCCCO)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H23F2NO2/c1-12(18-9-4-2-3-5-10-19)13-7-6-8-14(11-13)20-15(16)17/h6-8,11-12,15,18-19H,2-5,9-10H2,1H3 |
| InChIKey | TZGUBBONDUMHRB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|