C16H18F2N4O2 — CID 94651103
1-[(1R)-1-[4-(difluoromethoxy)phenyl]ethyl]-3-[(2-methylpyrimidin-4-yl)methyl]urea (PubChem CID 94651103) has the molecular formula C16H18F2N4O2 and a molecular weight of 336.34 g/mol. Its IUPAC name is 1-[(1R)-1-[4-(difluoromethoxy)phenyl]ethyl]-3-[(2-methylpyrimidin-4-yl)methyl]urea.
| Compound Name | 1-[(1R)-1-[4-(difluoromethoxy)phenyl]ethyl]-3-[(2-methylpyrimidin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 94651103 |
| Molecular Formula | C16H18F2N4O2 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-[(1R)-1-[4-(difluoromethoxy)phenyl]ethyl]-3-[(2-methylpyrimidin-4-yl)methyl]urea |
| SMILES | Cc1nccc(CNC(=O)N[C@H](C)c2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C16H18F2N4O2/c1-10(12-3-5-14(6-4-12)24-15(17)18)21-16(23)20-9-13-7-8-19-11(2)22-13/h3-8,10,15H,9H2,1-2H3,(H2,20,21,23)/t10-/m1/s1 |
| InChIKey | QRAJREFADDDRHG-SNVBAGLBSA-N |
| XLogP | 2.95 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |