C14H13ClF2N4O2 — CID 75451509
1-[4-chloro-3-(difluoromethoxy)phenyl]-3-[(2-methylpyrimidin-4-yl)methyl]urea (PubChem CID 75451509) has the molecular formula C14H13ClF2N4O2 and a molecular weight of 342.73 g/mol. Its IUPAC name is 1-[4-chloro-3-(difluoromethoxy)phenyl]-3-[(2-methylpyrimidin-4-yl)methyl]urea.
| Compound Name | 1-[4-chloro-3-(difluoromethoxy)phenyl]-3-[(2-methylpyrimidin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 75451509 |
| Molecular Formula | C14H13ClF2N4O2 |
| Molecular Weight | 342.73 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-[4-chloro-3-(difluoromethoxy)phenyl]-3-[(2-methylpyrimidin-4-yl)methyl]urea |
| SMILES | Cc1nccc(CNC(=O)Nc2ccc(Cl)c(OC(F)F)c2)n1 |
| InChI | InChI=1S/C14H13ClF2N4O2/c1-8-18-5-4-10(20-8)7-19-14(22)21-9-2-3-11(15)12(6-9)23-13(16)17/h2-6,13H,7H2,1H3,(H2,19,21,22) |
| InChIKey | YOKDKYUGKPLXPK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |