C11H13ClF2N2O2 — CID 86805225
N-[4-chloro-3-(difluoromethoxy)phenyl]-2-(dimethylamino)acetamide (PubChem CID 86805225) has the molecular formula C11H13ClF2N2O2 and a molecular weight of 278.69 g/mol. Its IUPAC name is N-[4-chloro-3-(difluoromethoxy)phenyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[4-chloro-3-(difluoromethoxy)phenyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 86805225 |
| Molecular Formula | C11H13ClF2N2O2 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | N-[4-chloro-3-(difluoromethoxy)phenyl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)Nc1ccc(Cl)c(OC(F)F)c1 |
| InChI | InChI=1S/C11H13ClF2N2O2/c1-16(2)6-10(17)15-7-3-4-8(12)9(5-7)18-11(13)14/h3-5,11H,6H2,1-2H3,(H,15,17) |
| InChIKey | SHNMQODJMMQNFH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |