C14H17ClF2N2O3 — CID 110021826
N-[4-chloro-3-(difluoromethoxy)phenyl]-3-hydroxy-4-methylpiperidine-1-carboxamide (PubChem CID 110021826) has the molecular formula C14H17ClF2N2O3 and a molecular weight of 334.75 g/mol. Its IUPAC name is N-[4-chloro-3-(difluoromethoxy)phenyl]-3-hydroxy-4-methylpiperidine-1-carboxamide.
| Compound Name | N-[4-chloro-3-(difluoromethoxy)phenyl]-3-hydroxy-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 110021826 |
| Molecular Formula | C14H17ClF2N2O3 |
| Molecular Weight | 334.75 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-[4-chloro-3-(difluoromethoxy)phenyl]-3-hydroxy-4-methylpiperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)Nc2ccc(Cl)c(OC(F)F)c2)CC1O |
| InChI | InChI=1S/C14H17ClF2N2O3/c1-8-4-5-19(7-11(8)20)14(21)18-9-2-3-10(15)12(6-9)22-13(16)17/h2-3,6,8,11,13,20H,4-5,7H2,1H3,(H,18,21) |
| InChIKey | BOGFLHQHXYOEMU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.75 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |