C13H17Cl2N3O — CID 79867440
4-amino-N-(3,4-dichlorophenyl)-3-methylpiperidine-1-carboxamide (PubChem CID 79867440) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.21 g/mol. Its IUPAC name is 4-amino-N-(3,4-dichlorophenyl)-3-methylpiperidine-1-carboxamide.
| Compound Name | 4-amino-N-(3,4-dichlorophenyl)-3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 79867440 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-amino-N-(3,4-dichlorophenyl)-3-methylpiperidine-1-carboxamide |
| SMILES | CC1CN(C(=O)Nc2ccc(Cl)c(Cl)c2)CCC1N |
| InChI | InChI=1S/C13H17Cl2N3O/c1-8-7-18(5-4-12(8)16)13(19)17-9-2-3-10(14)11(15)6-9/h2-3,6,8,12H,4-5,7,16H2,1H3,(H,17,19) |
| InChIKey | HDTOROXMRGKLDA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |