C16H22ClFN2O — CID 144845950
N-(3-chloro-4-fluorophenyl)-3,6-dimethylazocane-1-carboxamide (PubChem CID 144845950) has the molecular formula C16H22ClFN2O and a molecular weight of 312.82 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3,6-dimethylazocane-1-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3,6-dimethylazocane-1-carboxamide |
|---|---|
| PubChem CID | 144845950 |
| Molecular Formula | C16H22ClFN2O |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3,6-dimethylazocane-1-carboxamide |
| SMILES | CC1CCC(C)CN(C(=O)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H22ClFN2O/c1-11-3-4-12(2)10-20(8-7-11)16(21)19-13-5-6-15(18)14(17)9-13/h5-6,9,11-12H,3-4,7-8,10H2,1-2H3,(H,19,21) |
| InChIKey | OXODHVNKVGWMJQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |