C19H21ClFN3O — CID 108991879
1-(3-chloro-4-fluorophenyl)-3-[4-(4-methylpiperidin-1-yl)phenyl]urea (PubChem CID 108991879) has the molecular formula C19H21ClFN3O and a molecular weight of 361.85 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[4-(4-methylpiperidin-1-yl)phenyl]urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[4-(4-methylpiperidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 108991879 |
| Molecular Formula | C19H21ClFN3O |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[4-(4-methylpiperidin-1-yl)phenyl]urea |
| SMILES | CC1CCN(c2ccc(NC(=O)Nc3ccc(F)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C19H21ClFN3O/c1-13-8-10-24(11-9-13)16-5-2-14(3-6-16)22-19(25)23-15-4-7-18(21)17(20)12-15/h2-7,12-13H,8-11H2,1H3,(H2,22,23,25) |
| InChIKey | XENCHQGENOWRHM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|