C18H19ClFN3O — CID 109183526
N-(3-chloro-4-fluorophenyl)-5-(4-methylpiperidin-1-yl)pyridine-2-carboxamide (PubChem CID 109183526) has the molecular formula C18H19ClFN3O and a molecular weight of 347.82 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-(4-methylpiperidin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-(4-methylpiperidin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109183526 |
| Molecular Formula | C18H19ClFN3O |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-(4-methylpiperidin-1-yl)pyridine-2-carboxamide |
| SMILES | CC1CCN(c2ccc(C(=O)Nc3ccc(F)c(Cl)c3)nc2)CC1 |
| InChI | InChI=1S/C18H19ClFN3O/c1-12-6-8-23(9-7-12)14-3-5-17(21-11-14)18(24)22-13-2-4-16(20)15(19)10-13/h2-5,10-12H,6-9H2,1H3,(H,22,24) |
| InChIKey | VWKHRTPRFKSYDR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |