C18H19F2N3O — CID 109196527
N-(3,4-difluorophenyl)-5-(3-methylpiperidin-1-yl)pyridine-2-carboxamide (PubChem CID 109196527) has the molecular formula C18H19F2N3O and a molecular weight of 331.37 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-5-(3-methylpiperidin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-5-(3-methylpiperidin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109196527 |
| Molecular Formula | C18H19F2N3O |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-(3,4-difluorophenyl)-5-(3-methylpiperidin-1-yl)pyridine-2-carboxamide |
| SMILES | CC1CCCN(c2ccc(C(=O)Nc3ccc(F)c(F)c3)nc2)C1 |
| InChI | InChI=1S/C18H19F2N3O/c1-12-3-2-8-23(11-12)14-5-7-17(21-10-14)18(24)22-13-4-6-15(19)16(20)9-13/h4-7,9-10,12H,2-3,8,11H2,1H3,(H,22,24) |
| InChIKey | UBLOMVHDQSTXOA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |