C19H20F3N3O — CID 108992547
1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 108992547) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is 1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 108992547 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | CC1CCN(c2ccc(NC(=O)Nc3ccc(F)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C19H20F3N3O/c1-12-8-10-25(11-9-12)14-4-2-13(3-5-14)23-19(26)24-16-7-6-15(20)17(21)18(16)22/h2-7,12H,8-11H2,1H3,(H2,23,24,26) |
| InChIKey | XMEQNZNITNHZIK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|