C19H18F3N3O2 — CID 108527759
N-(4-piperidin-1-ylphenyl)-N'-(2,3,4-trifluorophenyl)oxamide (PubChem CID 108527759) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is N-(4-piperidin-1-ylphenyl)-N'-(2,3,4-trifluorophenyl)oxamide.
| Compound Name | N-(4-piperidin-1-ylphenyl)-N'-(2,3,4-trifluorophenyl)oxamide |
|---|---|
| PubChem CID | 108527759 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(4-piperidin-1-ylphenyl)-N'-(2,3,4-trifluorophenyl)oxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H18F3N3O2/c20-14-8-9-15(17(22)16(14)21)24-19(27)18(26)23-12-4-6-13(7-5-12)25-10-2-1-3-11-25/h4-9H,1-3,10-11H2,(H,23,26)(H,24,27) |
| InChIKey | JIGBZKLWGZBRAQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|