C15H21N3O2 — CID 47224104
N'-propan-2-yl-N-(4-pyrrolidin-1-ylphenyl)oxamide (PubChem CID 47224104) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N'-propan-2-yl-N-(4-pyrrolidin-1-ylphenyl)oxamide.
| Compound Name | N'-propan-2-yl-N-(4-pyrrolidin-1-ylphenyl)oxamide |
|---|---|
| PubChem CID | 47224104 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N'-propan-2-yl-N-(4-pyrrolidin-1-ylphenyl)oxamide |
| SMILES | CC(C)NC(=O)C(=O)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C15H21N3O2/c1-11(2)16-14(19)15(20)17-12-5-7-13(8-6-12)18-9-3-4-10-18/h5-8,11H,3-4,9-10H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | PAMJJYWVXLDEPE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|