C18H18FN3O2 — CID 108987038
N'-(4-fluorophenyl)-N-(4-pyrrolidin-1-ylphenyl)oxamide (PubChem CID 108987038) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N-(4-pyrrolidin-1-ylphenyl)oxamide.
| Compound Name | N'-(4-fluorophenyl)-N-(4-pyrrolidin-1-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108987038 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N'-(4-fluorophenyl)-N-(4-pyrrolidin-1-ylphenyl)oxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C(=O)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C18H18FN3O2/c19-13-3-5-14(6-4-13)20-17(23)18(24)21-15-7-9-16(10-8-15)22-11-1-2-12-22/h3-10H,1-2,11-12H2,(H,20,23)(H,21,24) |
| InChIKey | NKFPKUZUMWKUNK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|