C21H20FN3O — CID 957135
(E)-2-cyano-N-(4-fluorophenyl)-3-(4-piperidin-1-ylphenyl)prop-2-enamide (PubChem CID 957135) has the molecular formula C21H20FN3O and a molecular weight of 349.41 g/mol. Its IUPAC name is (E)-2-cyano-N-(4-fluorophenyl)-3-(4-piperidin-1-ylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(4-fluorophenyl)-3-(4-piperidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 957135 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (E)-2-cyano-N-(4-fluorophenyl)-3-(4-piperidin-1-ylphenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(N2CCCCC2)cc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FN3O/c22-18-6-8-19(9-7-18)24-21(26)17(15-23)14-16-4-10-20(11-5-16)25-12-2-1-3-13-25/h4-11,14H,1-3,12-13H2,(H,24,26)/b17-14+ |
| InChIKey | UUNPXUHVODZWRL-SAPNQHFASA-N |
| XLogP | 4.36 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|