C17H11FN2O3 — CID 2094514
4-[[(Z)-2-cyano-3-(4-fluorophenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 2094514) has the molecular formula C17H11FN2O3 and a molecular weight of 310.28 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(4-fluorophenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-(4-fluorophenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2094514 |
| Molecular Formula | C17H11FN2O3 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(4-fluorophenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C/c1ccc(F)cc1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H11FN2O3/c18-14-5-1-11(2-6-14)9-13(10-19)16(21)20-15-7-3-12(4-8-15)17(22)23/h1-9H,(H,20,21)(H,22,23)/b13-9- |
| InChIKey | GPULDWFLYUTLJP-LCYFTJDESA-N |
| XLogP | 3.07 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|