C18H11F3N2O3S — CID 24542247
4-[[(E)-2-cyano-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 24542247) has the molecular formula C18H11F3N2O3S and a molecular weight of 392.36 g/mol. Its IUPAC name is 4-[[(E)-2-cyano-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(E)-2-cyano-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 24542247 |
| Molecular Formula | C18H11F3N2O3S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 4-[[(E)-2-cyano-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(SC(F)(F)F)cc1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H11F3N2O3S/c19-18(20,21)27-15-7-1-11(2-8-15)9-13(10-22)16(24)23-14-5-3-12(4-6-14)17(25)26/h1-9H,(H,23,24)(H,25,26)/b13-9+ |
| InChIKey | CDMJCZLOTMSZLN-UKTHLTGXSA-N |
| XLogP | 4.54 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|