C22H22N4O3 — CID 108823346
4-[[(Z)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enoyl]amino]benzoic acid (PubChem CID 108823346) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108823346 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C/Nc1ccc(N2CCCCC2)cc1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H22N4O3/c23-14-17(21(27)25-19-6-4-16(5-7-19)22(28)29)15-24-18-8-10-20(11-9-18)26-12-2-1-3-13-26/h4-11,15,24H,1-3,12-13H2,(H,25,27)(H,28,29)/b17-15- |
| InChIKey | BJAVYTKNADTDPB-ICFOKQHNSA-N |
| XLogP | 3.83 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|