C18H22N4O3 — CID 108844878
2-[[(Z)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enoyl]amino]propanoic acid (PubChem CID 108844878) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108844878 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)/C(C#N)=C\Nc1ccc(N2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C18H22N4O3/c1-13(18(24)25)21-17(23)14(11-19)12-20-15-5-7-16(8-6-15)22-9-3-2-4-10-22/h5-8,12-13,20H,2-4,9-10H2,1H3,(H,21,23)(H,24,25)/b14-12- |
| InChIKey | MQRIJDSLDRMNFM-OWBHPGMISA-N |
| XLogP | 2.09 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|