C21H29N5O2 — CID 108863096
(Z)-2-cyano-N-(2-morpholin-4-ylethyl)-3-(4-piperidin-1-ylanilino)prop-2-enamide (PubChem CID 108863096) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-morpholin-4-ylethyl)-3-(4-piperidin-1-ylanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-morpholin-4-ylethyl)-3-(4-piperidin-1-ylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108863096 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (Z)-2-cyano-N-(2-morpholin-4-ylethyl)-3-(4-piperidin-1-ylanilino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(N2CCCCC2)cc1)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C21H29N5O2/c22-16-18(21(27)23-8-11-25-12-14-28-15-13-25)17-24-19-4-6-20(7-5-19)26-9-2-1-3-10-26/h4-7,17,24H,1-3,8-15H2,(H,23,27)/b18-17- |
| InChIKey | FWAXDQHTCPBKAS-ZCXUNETKSA-N |
| XLogP | 1.94 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|