C25H30N4O3 — CID 108836354
(Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-piperidin-1-ylanilino)prop-2-enamide (PubChem CID 108836354) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is (Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-piperidin-1-ylanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-piperidin-1-ylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108836354 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (Z)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-piperidin-1-ylanilino)prop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)/C(C#N)=C\Nc2ccc(N3CCCCC3)cc2)cc1OC |
| InChI | InChI=1S/C25H30N4O3/c1-31-23-11-6-19(16-24(23)32-2)12-13-27-25(30)20(17-26)18-28-21-7-9-22(10-8-21)29-14-4-3-5-15-29/h6-11,16,18,28H,3-5,12-15H2,1-2H3,(H,27,30)/b20-18- |
| InChIKey | NBBWERWQURIRRJ-ZZEZOPTASA-N |
| XLogP | 3.87 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|