C21H22N4O4 — CID 108836388
4-[[(Z)-2-cyano-3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzamide (PubChem CID 108836388) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzamide.
| Compound Name | 4-[[(Z)-2-cyano-3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzamide |
|---|---|
| PubChem CID | 108836388 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-[2-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzamide |
| SMILES | COc1ccc(CCNC(=O)/C(C#N)=C\Nc2ccc(C(N)=O)cc2)cc1OC |
| InChI | InChI=1S/C21H22N4O4/c1-28-18-8-3-14(11-19(18)29-2)9-10-24-21(27)16(12-22)13-25-17-6-4-15(5-7-17)20(23)26/h3-8,11,13,25H,9-10H2,1-2H3,(H2,23,26)(H,24,27)/b16-13- |
| InChIKey | DGAYXBSCTOMLDJ-SSZFMOIBSA-N |
| XLogP | 1.98 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|